C16H31Cl2N2O12P — CID 67728644
(2-chloroethylamino)-[2-chloroethyl-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]amino]phosphinic acid (PubChem CID 67728644) has the molecular formula C16H31Cl2N2O12P and a molecular weight of 545.31 g/mol. Its IUPAC name is (2-chloroethylamino)-[2-chloroethyl-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]amino]phosphinic acid.
| Compound Name | (2-chloroethylamino)-[2-chloroethyl-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]amino]phosphinic acid |
|---|---|
| PubChem CID | 67728644 |
| Molecular Formula | C16H31Cl2N2O12P |
| Molecular Weight | 545.31 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | (2-chloroethylamino)-[2-chloroethyl-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]amino]phosphinic acid |
| SMILES | O=P(O)(NCCCl)N(CCCl)[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H31Cl2N2O12P/c17-1-3-19-33(28,29)20(4-2-18)15-12(26)11(25)14(8(6-22)30-15)32-16-13(27)10(24)9(23)7(5-21)31-16/h7-16,21-27H,1-6H2,(H2,19,28,29)/t7-,8-,9-,10+,11-,12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | LVEMSTLKTNATIR-KPNIBBNDSA-N |
| XLogP | -3.92 |
| TPSA | 221.87 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.31 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|