C23H35ClN2O11 — CID 54462325
3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-[(4-methylphenyl)methyl]urea (PubChem CID 54462325) has the molecular formula C23H35ClN2O11 and a molecular weight of 550.99 g/mol. Its IUPAC name is 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-[(4-methylphenyl)methyl]urea.
| Compound Name | 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 54462325 |
| Molecular Formula | C23H35ClN2O11 |
| Molecular Weight | 550.99 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-1-[(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc(CN(C(=O)NCCCl)C2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H35ClN2O11/c1-11-2-4-12(5-3-11)8-26(23(34)25-7-6-24)21-18(32)17(31)20(14(10-28)35-21)37-22-19(33)16(30)15(29)13(9-27)36-22/h2-5,13-22,27-33H,6-10H2,1H3,(H,25,34)/t13-,14-,15-,16+,17-,18-,19-,20-,21?,22-/m1/s1 |
| InChIKey | XCLUIKSCRATFGQ-VISPMFAPSA-N |
| XLogP | -2.63 |
| TPSA | 201.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.99 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|