C19H34ClN3O12 — CID 13092722
1-butyl-3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-3-nitrosourea (PubChem CID 13092722) has the molecular formula C19H34ClN3O12 and a molecular weight of 531.94 g/mol. Its IUPAC name is 1-butyl-3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-3-nitrosourea.
| Compound Name | 1-butyl-3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-3-nitrosourea |
|---|---|
| PubChem CID | 13092722 |
| Molecular Formula | C19H34ClN3O12 |
| Molecular Weight | 531.94 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 1-butyl-3-(2-chloroethyl)-1-[(3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]-3-nitrosourea |
| SMILES | CCCCN(C(=O)N(CCCl)N=O)C1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H34ClN3O12/c1-2-3-5-22(19(31)23(21-32)6-4-20)17-14(29)13(28)16(10(8-25)33-17)35-18-15(30)12(27)11(26)9(7-24)34-18/h9-18,24-30H,2-8H2,1H3/t9-,10-,11-,12+,13-,14-,15-,16-,17?,18-/m1/s1 |
| InChIKey | OTMSLVLZZSIXBF-MRRBZYCWSA-N |
| XLogP | -2.95 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.94 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|