C11H20ClN3O7 — CID 13092720
1-(2-chloroethyl)-3-ethyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea (PubChem CID 13092720) has the molecular formula C11H20ClN3O7 and a molecular weight of 341.75 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-ethyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea.
| Compound Name | 1-(2-chloroethyl)-3-ethyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 13092720 |
| Molecular Formula | C11H20ClN3O7 |
| Molecular Weight | 341.75 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 1-(2-chloroethyl)-3-ethyl-1-nitroso-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
| SMILES | CCN(C(=O)N(CCCl)N=O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H20ClN3O7/c1-2-14(11(20)15(13-21)4-3-12)10-9(19)8(18)7(17)6(5-16)22-10/h6-10,16-19H,2-5H2,1H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | DNRPUPAFYAEHGM-ZKZCYXTQSA-N |
| XLogP | -1.55 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.75 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|