C7H13N3O7 — CID 88701616
1-nitroso-1-[(3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea (PubChem CID 88701616) has the molecular formula C7H13N3O7 and a molecular weight of 251.19 g/mol. Its IUPAC name is 1-nitroso-1-[(3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea.
| Compound Name | 1-nitroso-1-[(3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
|---|---|
| PubChem CID | 88701616 |
| Molecular Formula | C7H13N3O7 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-nitroso-1-[(3R,4S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]urea |
| SMILES | NC(=O)N(N=O)C1OC(CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H13N3O7/c8-7(15)10(9-16)6-5(14)4(13)3(12)2(1-11)17-6/h2-6,11-14H,1H2,(H2,8,15)/t2?,3-,4+,5-,6?/m1/s1 |
| InChIKey | VMTFEJIHPGBGJO-UWWPDOAWSA-N |
| XLogP | -3.15 |
| TPSA | 165.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|