C9H19N3O5 — CID 164585397
2-[amino-[(Z)-2-aminoprop-1-enyl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 164585397) has the molecular formula C9H19N3O5 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-[amino-[(Z)-2-aminoprop-1-enyl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[amino-[(Z)-2-aminoprop-1-enyl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 164585397 |
| Molecular Formula | C9H19N3O5 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-[amino-[(Z)-2-aminoprop-1-enyl]amino]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C/C(N)=C/N(N)C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C9H19N3O5/c1-4(10)2-12(11)9-8(16)7(15)6(14)5(3-13)17-9/h2,5-9,13-16H,3,10-11H2,1H3/b4-2- |
| InChIKey | KGFQCRKOJUNSEK-RQOWECAXSA-N |
| XLogP | -3.22 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|