C7H14N2O5 — CID 154723410
3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboximidamide (PubChem CID 154723410) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboximidamide.
| Compound Name | 3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboximidamide |
|---|---|
| PubChem CID | 154723410 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3,4,5-trihydroxy-6-(hydroxymethyl)oxane-2-carboximidamide |
| SMILES | [H]/N=C(\N)C1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H14N2O5/c8-7(9)6-5(13)4(12)3(11)2(1-10)14-6/h2-6,10-13H,1H2,(H3,8,9) |
| InChIKey | YBFRXRBDUSMBTB-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|