C11H19ClN4O7 — CID 54008187
N-[(2R,3R,4R,5S,6R)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 54008187) has the molecular formula C11H19ClN4O7 and a molecular weight of 354.75 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S,6R)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S,6R)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 54008187 |
| Molecular Formula | C11H19ClN4O7 |
| Molecular Weight | 354.75 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1NC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C11H19ClN4O7/c1-5(18)13-7-9(20)8(19)6(4-17)23-10(7)14-11(21)16(15-22)3-2-12/h6-10,17,19-20H,2-4H2,1H3,(H,13,18)(H,14,21)/t6-,7-,8-,9-,10-/m1/s1 |
| InChIKey | KQJSTXDNNDPWMI-VVULQXIFSA-N |
| XLogP | -2.14 |
| TPSA | 160.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.75 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|