C10H18ClN3O5 — CID 14280436
1-(2-chloroethyl)-3-[(2S,3R,4S,6R)-3-hydroxy-2-methoxy-6-methyloxan-4-yl]-1-nitrosourea (PubChem CID 14280436) has the molecular formula C10H18ClN3O5 and a molecular weight of 295.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(2S,3R,4S,6R)-3-hydroxy-2-methoxy-6-methyloxan-4-yl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[(2S,3R,4S,6R)-3-hydroxy-2-methoxy-6-methyloxan-4-yl]-1-nitrosourea |
|---|---|
| PubChem CID | 14280436 |
| Molecular Formula | C10H18ClN3O5 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(2S,3R,4S,6R)-3-hydroxy-2-methoxy-6-methyloxan-4-yl]-1-nitrosourea |
| SMILES | CO[C@H]1O[C@H](C)C[C@H](NC(=O)N(CCCl)N=O)[C@H]1O |
| InChI | InChI=1S/C10H18ClN3O5/c1-6-5-7(8(15)9(18-2)19-6)12-10(16)14(13-17)4-3-11/h6-9,15H,3-5H2,1-2H3,(H,12,16)/t6-,7+,8-,9+/m1/s1 |
| InChIKey | AXFCMHOXGKLUQW-XAVMHZPKSA-N |
| XLogP | 0.43 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|