C10H18ClN3O7 — CID 124921536
1-(2-chloroethyl)-1-nitroso-3-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]urea (PubChem CID 124921536) has the molecular formula C10H18ClN3O7 and a molecular weight of 327.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 124921536 |
| Molecular Formula | C10H18ClN3O7 |
| Molecular Weight | 327.72 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-[[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]urea |
| SMILES | CO[C@@H]1O[C@H](CNC(=O)N(CCCl)N=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18ClN3O7/c1-20-9-8(17)7(16)6(15)5(21-9)4-12-10(18)14(13-19)3-2-11/h5-9,15-17H,2-4H2,1H3,(H,12,18)/t5-,6+,7-,8+,9-/m1/s1 |
| InChIKey | AHHFEZNOXOZZQA-QKCLAQEOSA-N |
| XLogP | -1.63 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.72 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|