C12H22ClN3O5 — CID 23621334
acetic acid;1-(2-chloroethyl)-3-[(4-hydroxycyclohexyl)methyl]-1-nitrosourea (PubChem CID 23621334) has the molecular formula C12H22ClN3O5 and a molecular weight of 323.78 g/mol. Its IUPAC name is acetic acid;1-(2-chloroethyl)-3-[(4-hydroxycyclohexyl)methyl]-1-nitrosourea.
| Compound Name | acetic acid;1-(2-chloroethyl)-3-[(4-hydroxycyclohexyl)methyl]-1-nitrosourea |
|---|---|
| PubChem CID | 23621334 |
| Molecular Formula | C12H22ClN3O5 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | acetic acid;1-(2-chloroethyl)-3-[(4-hydroxycyclohexyl)methyl]-1-nitrosourea |
| SMILES | CC(=O)O.O=NN(CCCl)C(=O)NCC1CCC(O)CC1 |
| InChI | InChI=1S/C10H18ClN3O3.C2H4O2/c11-5-6-14(13-17)10(16)12-7-8-1-3-9(15)4-2-8;1-2(3)4/h8-9,15H,1-7H2,(H,12,16);1H3,(H,3,4) |
| InChIKey | NOINECIULMLOGP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|