C12H26ClN3O2Si — CID 71334036
1-(2-chloroethyl)-1-nitroso-3-(3-triethylsilylpropyl)urea (PubChem CID 71334036) has the molecular formula C12H26ClN3O2Si and a molecular weight of 307.90 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-(3-triethylsilylpropyl)urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-(3-triethylsilylpropyl)urea |
|---|---|
| PubChem CID | 71334036 |
| Molecular Formula | C12H26ClN3O2Si |
| Molecular Weight | 307.90 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-(3-triethylsilylpropyl)urea |
| SMILES | CC[Si](CC)(CC)CCCNC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C12H26ClN3O2Si/c1-4-19(5-2,6-3)11-7-9-14-12(17)16(15-18)10-8-13/h4-11H2,1-3H3,(H,14,17) |
| InChIKey | MLOPJEJWRXFSHD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|