C7H15ClN4O2S2 — CID 87233521
3-[2-(2-aminoethyldisulfanyl)ethyl]-1-(2-chloroethyl)-1-nitrosourea (PubChem CID 87233521) has the molecular formula C7H15ClN4O2S2 and a molecular weight of 286.81 g/mol. Its IUPAC name is 3-[2-(2-aminoethyldisulfanyl)ethyl]-1-(2-chloroethyl)-1-nitrosourea.
| Compound Name | 3-[2-(2-aminoethyldisulfanyl)ethyl]-1-(2-chloroethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 87233521 |
| Molecular Formula | C7H15ClN4O2S2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-[2-(2-aminoethyldisulfanyl)ethyl]-1-(2-chloroethyl)-1-nitrosourea |
| SMILES | NCCSSCCNC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C7H15ClN4O2S2/c8-1-4-12(11-14)7(13)10-3-6-16-15-5-2-9/h1-6,9H2,(H,10,13) |
| InChIKey | BEBVVULNUONIAM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|