C12H17ClN4O4 — CID 15680047
2-[[2-chloroethyl(nitroso)carbamoyl]amino]ethyl 1-methyl-4H-pyridine-3-carboxylate (PubChem CID 15680047) has the molecular formula C12H17ClN4O4 and a molecular weight of 316.75 g/mol. Its IUPAC name is 2-[[2-chloroethyl(nitroso)carbamoyl]amino]ethyl 1-methyl-4H-pyridine-3-carboxylate.
| Compound Name | 2-[[2-chloroethyl(nitroso)carbamoyl]amino]ethyl 1-methyl-4H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 15680047 |
| Molecular Formula | C12H17ClN4O4 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-[[2-chloroethyl(nitroso)carbamoyl]amino]ethyl 1-methyl-4H-pyridine-3-carboxylate |
| SMILES | CN1C=CCC(C(=O)OCCNC(=O)N(CCCl)N=O)=C1 |
| InChI | InChI=1S/C12H17ClN4O4/c1-16-6-2-3-10(9-16)11(18)21-8-5-14-12(19)17(15-20)7-4-13/h2,6,9H,3-5,7-8H2,1H3,(H,14,19) |
| InChIKey | SZVHJUMJJXAAHZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|