C15H18N2O3 — CID 14050428
N-[2-(3,4-dihydroxyphenyl)ethyl]-1-methyl-4H-pyridine-3-carboxamide (PubChem CID 14050428) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-1-methyl-4H-pyridine-3-carboxamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-1-methyl-4H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 14050428 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-1-methyl-4H-pyridine-3-carboxamide |
| SMILES | CN1C=CCC(C(=O)NCCc2ccc(O)c(O)c2)=C1 |
| InChI | InChI=1S/C15H18N2O3/c1-17-8-2-3-12(10-17)15(20)16-7-6-11-4-5-13(18)14(19)9-11/h2,4-5,8-10,18-19H,3,6-7H2,1H3,(H,16,20) |
| InChIKey | NQOOGLWWLYENTC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|