C12H17NO4 — CID 90161790
N-[2-(3,4-dihydroxyphenyl)ethyl]-3-methoxypropanamide (PubChem CID 90161790) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3-methoxypropanamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 90161790 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3-methoxypropanamide |
| SMILES | COCCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H17NO4/c1-17-7-5-12(16)13-6-4-9-2-3-10(14)11(15)8-9/h2-3,8,14-15H,4-7H2,1H3,(H,13,16) |
| InChIKey | UQXCOWYEZNTORV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|