C19H23NO3 — CID 122159315
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2,4,6-trimethylphenyl)acetamide (PubChem CID 122159315) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 122159315 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(CC(=O)NCCc2ccc(O)c(O)c2)c(C)c1 |
| InChI | InChI=1S/C19H23NO3/c1-12-8-13(2)16(14(3)9-12)11-19(23)20-7-6-15-4-5-17(21)18(22)10-15/h4-5,8-10,21-22H,6-7,11H2,1-3H3,(H,20,23) |
| InChIKey | ABKAZKYGFDLVMF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|