C20H21NO4 — CID 78796855
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide (PubChem CID 78796855) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 78796855 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)NCCc3ccc(O)c(O)c3)coc2c1C |
| InChI | InChI=1S/C20H21NO4/c1-12-3-5-16-15(11-25-20(16)13(12)2)10-19(24)21-8-7-14-4-6-17(22)18(23)9-14/h3-6,9,11,22-23H,7-8,10H2,1-2H3,(H,21,24) |
| InChIKey | MJEHMOPGERVNSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|