About 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide
2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide (PubChem CID 112771768) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide |
| PubChem CID | 112771768 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3cc([N+](=O)[O-])ccc3O)coc2c1C |
| InChI | InChI=1S/C18H16N2O5/c1-10-3-5-14-12(9-25-18(14)11(10)2)7-17(22)19-15-8-13(20(23)24)4-6-16(15)21/h3-6,8-9,21H,7H2,1-2H3,(H,19,22) |
| InChIKey | AOEAGVUEXLFGIB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide?
The IUPAC name of 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide (CID 112771768) is 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide.
What is the SMILES notation for 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide?
The canonical SMILES for 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide is Cc1ccc2c(CC(=O)Nc3cc([N+](=O)[O-])ccc3O)coc2c1C.
What is the InChIKey of 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide?
The InChIKey is AOEAGVUEXLFGIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5/c1-10-3-5-14-12(9-25-18(14)11(10)2)7-17(22)19-15-8-13(20(23)24)4-6-16(15)21/h3-6,8-9,21H,7H2,1-2H3,(H,19,22).
What are the key properties of 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide?
2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide has a molecular weight of 340.34 g/mol, XLogP of 3.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethyl-1-benzofuran-3-yl)-N-(2-hydroxy-5-nitrophenyl)acetamide is sourced from PubChem (CID 112771768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).