C20H23ClN2O2 — CID 119548906
N-[2-(4-aminophenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide;hydrochloride (PubChem CID 119548906) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119548906 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-2-(6,7-dimethyl-1-benzofuran-3-yl)acetamide;hydrochloride |
| SMILES | Cc1ccc2c(CC(=O)NCCc3ccc(N)cc3)coc2c1C.Cl |
| InChI | InChI=1S/C20H22N2O2.ClH/c1-13-3-8-18-16(12-24-20(18)14(13)2)11-19(23)22-10-9-15-4-6-17(21)7-5-15;/h3-8,12H,9-11,21H2,1-2H3,(H,22,23);1H |
| InChIKey | KAPZSALSNIORBC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|