C22H20N2O4 — CID 78799601
2-benzamido-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide (PubChem CID 78799601) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-benzamido-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide.
| Compound Name | 2-benzamido-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78799601 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-benzamido-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCc1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c25-19-11-10-15(14-20(19)26)12-13-23-22(28)17-8-4-5-9-18(17)24-21(27)16-6-2-1-3-7-16/h1-11,14,25-26H,12-13H2,(H,23,28)(H,24,27) |
| InChIKey | PVZFFDGIWXSFAU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|