C20H18N2O3 — CID 18102051
N-[2-(2-phenylethylcarbamoyl)phenyl]furan-3-carboxamide (PubChem CID 18102051) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[2-(2-phenylethylcarbamoyl)phenyl]furan-3-carboxamide.
| Compound Name | N-[2-(2-phenylethylcarbamoyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 18102051 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-[2-(2-phenylethylcarbamoyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCc1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C20H18N2O3/c23-19(16-11-13-25-14-16)22-18-9-5-4-8-17(18)20(24)21-12-10-15-6-2-1-3-7-15/h1-9,11,13-14H,10,12H2,(H,21,24)(H,22,23) |
| InChIKey | NEDYHAZCMHHAHJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |