C25H25N3O3 — CID 33252278
2-[[2-[(2-phenylacetyl)amino]acetyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 33252278) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[2-[(2-phenylacetyl)amino]acetyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[2-[(2-phenylacetyl)amino]acetyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 33252278 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[[2-[(2-phenylacetyl)amino]acetyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(Cc1ccccc1)NCC(=O)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C25H25N3O3/c29-23(17-20-11-5-2-6-12-20)27-18-24(30)28-22-14-8-7-13-21(22)25(31)26-16-15-19-9-3-1-4-10-19/h1-14H,15-18H2,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | ZDUJOXVUWDEHPA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |