C23H25N3O2S — CID 17453541
N-(2-phenylethyl)-2-[[2-(1-thiophen-2-ylethylamino)acetyl]amino]benzamide (PubChem CID 17453541) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-[[2-(1-thiophen-2-ylethylamino)acetyl]amino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-[[2-(1-thiophen-2-ylethylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17453541 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-(2-phenylethyl)-2-[[2-(1-thiophen-2-ylethylamino)acetyl]amino]benzamide |
| SMILES | CC(NCC(=O)Nc1ccccc1C(=O)NCCc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C23H25N3O2S/c1-17(21-12-7-15-29-21)25-16-22(27)26-20-11-6-5-10-19(20)23(28)24-14-13-18-8-3-2-4-9-18/h2-12,15,17,25H,13-14,16H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | OLZLCNLQHKDPFI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |