C9H20ClN3O9P2 — CID 19391839
[6-[[2-chloroethyl(nitroso)carbamoyl]amino]-1-hydroxy-1-phosphonohexyl]phosphonic acid (PubChem CID 19391839) has the molecular formula C9H20ClN3O9P2 and a molecular weight of 411.67 g/mol. Its IUPAC name is [6-[[2-chloroethyl(nitroso)carbamoyl]amino]-1-hydroxy-1-phosphonohexyl]phosphonic acid.
| Compound Name | [6-[[2-chloroethyl(nitroso)carbamoyl]amino]-1-hydroxy-1-phosphonohexyl]phosphonic acid |
|---|---|
| PubChem CID | 19391839 |
| Molecular Formula | C9H20ClN3O9P2 |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [6-[[2-chloroethyl(nitroso)carbamoyl]amino]-1-hydroxy-1-phosphonohexyl]phosphonic acid |
| SMILES | O=NN(CCCl)C(=O)NCCCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C9H20ClN3O9P2/c10-5-7-13(12-16)8(14)11-6-3-1-2-4-9(15,23(17,18)19)24(20,21)22/h15H,1-7H2,(H,11,14)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | ANAOZDJRFLZZFV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|