C8H12ClN5O2 — CID 14374013
1-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)-1-nitrosourea (PubChem CID 14374013) has the molecular formula C8H12ClN5O2 and a molecular weight of 245.67 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)-1-nitrosourea |
|---|---|
| PubChem CID | 14374013 |
| Molecular Formula | C8H12ClN5O2 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2-imidazol-1-ylethyl)-1-nitrosourea |
| SMILES | O=NN(CCCl)C(=O)NCCn1ccnc1 |
| InChI | InChI=1S/C8H12ClN5O2/c9-1-4-14(12-16)8(15)11-3-6-13-5-2-10-7-13/h2,5,7H,1,3-4,6H2,(H,11,15) |
| InChIKey | XRIXPFNXKKJDLC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|