C14H21N7O2 — CID 164606173
1-carbamoyl-1,3-bis(3-imidazol-1-ylpropyl)urea (PubChem CID 164606173) has the molecular formula C14H21N7O2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-carbamoyl-1,3-bis(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-carbamoyl-1,3-bis(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 164606173 |
| Molecular Formula | C14H21N7O2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-carbamoyl-1,3-bis(3-imidazol-1-ylpropyl)urea |
| SMILES | NC(=O)N(CCCn1ccnc1)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C14H21N7O2/c15-13(22)21(8-2-7-20-10-5-17-12-20)14(23)18-3-1-6-19-9-4-16-11-19/h4-5,9-12H,1-3,6-8H2,(H2,15,22)(H,18,23) |
| InChIKey | RQRSFPARZCSRAT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|