C13H22ClN5O4 — CID 3052551
1-(2-chloroethyl)-3-[4-(4-ethyl-2,3-dioxopiperazin-1-yl)butyl]-1-nitrosourea (PubChem CID 3052551) has the molecular formula C13H22ClN5O4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[4-(4-ethyl-2,3-dioxopiperazin-1-yl)butyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[4-(4-ethyl-2,3-dioxopiperazin-1-yl)butyl]-1-nitrosourea |
|---|---|
| PubChem CID | 3052551 |
| Molecular Formula | C13H22ClN5O4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-(2-chloroethyl)-3-[4-(4-ethyl-2,3-dioxopiperazin-1-yl)butyl]-1-nitrosourea |
| SMILES | CCN1CCN(CCCCNC(=O)N(CCCl)N=O)C(=O)C1=O |
| InChI | InChI=1S/C13H22ClN5O4/c1-2-17-9-10-18(12(21)11(17)20)7-4-3-6-15-13(22)19(16-23)8-5-14/h2-10H2,1H3,(H,15,22) |
| InChIKey | ROVTXEQJZDORFA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 102.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|