C9H16N2O2 — CID 12707289
1,4-diethyl-1,4-diazepane-2,3-dione (PubChem CID 12707289) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1,4-diethyl-1,4-diazepane-2,3-dione.
| Compound Name | 1,4-diethyl-1,4-diazepane-2,3-dione |
|---|---|
| PubChem CID | 12707289 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1,4-diethyl-1,4-diazepane-2,3-dione |
| SMILES | CCN1CCCN(CC)C(=O)C1=O |
| InChI | InChI=1S/C9H16N2O2/c1-3-10-6-5-7-11(4-2)9(13)8(10)12/h3-7H2,1-2H3 |
| InChIKey | XYGJYVJAMNJPQT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|