About 1-ethylpyrrolidin-2-one;hydrazine
1-ethylpyrrolidin-2-one;hydrazine (PubChem CID 159147234) has the molecular formula C6H15N3O
and a molecular weight of 145.21 g/mol. Its IUPAC name is 1-ethylpyrrolidin-2-one;hydrazine.
Molecular Properties
| Compound Name | 1-ethylpyrrolidin-2-one;hydrazine |
| PubChem CID | 159147234 |
| Molecular Formula | C6H15N3O |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.12 |
| IUPAC Name | 1-ethylpyrrolidin-2-one;hydrazine |
| SMILES | CCN1CCCC1=O.NN |
| InChI | InChI=1S/C6H11NO.H4N2/c1-2-7-5-3-4-6(7)8;1-2/h2-5H2,1H3;1-2H2 |
| InChIKey | KIVJMUYVXSPQQJ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyrrolidin-2-one;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidin-2-one;hydrazine?
The IUPAC name of 1-ethylpyrrolidin-2-one;hydrazine (CID 159147234) is 1-ethylpyrrolidin-2-one;hydrazine.
What is the SMILES notation for 1-ethylpyrrolidin-2-one;hydrazine?
The canonical SMILES for 1-ethylpyrrolidin-2-one;hydrazine is CCN1CCCC1=O.NN.
What is the InChIKey of 1-ethylpyrrolidin-2-one;hydrazine?
The InChIKey is KIVJMUYVXSPQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.H4N2/c1-2-7-5-3-4-6(7)8;1-2/h2-5H2,1H3;1-2H2.
What are the key properties of 1-ethylpyrrolidin-2-one;hydrazine?
1-ethylpyrrolidin-2-one;hydrazine has a molecular weight of 145.21 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-2-one;hydrazine is sourced from PubChem (CID 159147234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).