1-ethylpyrrolidin-2-one;sulfuric acid

C6H13NO5S — CID 174895849

IUPAC1-ethylpyrrolidin-2-one;sulfuric acid
SMILESCCN1CCCC1=O.O=S(=O)(O)O
InChIInChI=1S/C6H11NO.H2O4S/c1-2-7-5-3-4-6(7)8;1-5(2,3)4/h2-5H2,1H3;(H2,1,2,3,4)
InChIKeyAIOHZEPTGMSZSS-UHFFFAOYSA-N
MW211.24 g/mol
LogP-0.02
Rot. Bonds1

About 1-ethylpyrrolidin-2-one;sulfuric acid

1-ethylpyrrolidin-2-one;sulfuric acid (PubChem CID 174895849) has the molecular formula C6H13NO5S and a molecular weight of 211.24 g/mol. Its IUPAC name is 1-ethylpyrrolidin-2-one;sulfuric acid.

Molecular Properties

Compound Name1-ethylpyrrolidin-2-one;sulfuric acid
PubChem CID174895849
Molecular FormulaC6H13NO5S
Molecular Weight211.24 g/mol
Exact Mass211.05
IUPAC Name1-ethylpyrrolidin-2-one;sulfuric acid
SMILESCCN1CCCC1=O.O=S(=O)(O)O
InChIInChI=1S/C6H11NO.H2O4S/c1-2-7-5-3-4-6(7)8;1-5(2,3)4/h2-5H2,1H3;(H2,1,2,3,4)
InChIKeyAIOHZEPTGMSZSS-UHFFFAOYSA-N
XLogP-0.02
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.24
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-ethylpyrrolidin-2-one;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethylpyrrolidin-2-one;sulfuric acid?
The IUPAC name of 1-ethylpyrrolidin-2-one;sulfuric acid (CID 174895849) is 1-ethylpyrrolidin-2-one;sulfuric acid.
What is the SMILES notation for 1-ethylpyrrolidin-2-one;sulfuric acid?
The canonical SMILES for 1-ethylpyrrolidin-2-one;sulfuric acid is CCN1CCCC1=O.O=S(=O)(O)O.
What is the InChIKey of 1-ethylpyrrolidin-2-one;sulfuric acid?
The InChIKey is AIOHZEPTGMSZSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.H2O4S/c1-2-7-5-3-4-6(7)8;1-5(2,3)4/h2-5H2,1H3;(H2,1,2,3,4).
What are the key properties of 1-ethylpyrrolidin-2-one;sulfuric acid?
1-ethylpyrrolidin-2-one;sulfuric acid has a molecular weight of 211.24 g/mol, XLogP of -0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-2-one;sulfuric acid is sourced from PubChem (CID 174895849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).