C16H33NO4S — CID 174526304
butane-1-sulfonic acid;1-octylpyrrolidin-2-one (PubChem CID 174526304) has the molecular formula C16H33NO4S and a molecular weight of 335.51 g/mol. Its IUPAC name is butane-1-sulfonic acid;1-octylpyrrolidin-2-one.
| Compound Name | butane-1-sulfonic acid;1-octylpyrrolidin-2-one |
|---|---|
| PubChem CID | 174526304 |
| Molecular Formula | C16H33NO4S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | butane-1-sulfonic acid;1-octylpyrrolidin-2-one |
| SMILES | CCCCCCCCN1CCCC1=O.CCCCS(=O)(=O)O |
| InChI | InChI=1S/C12H23NO.C4H10O3S/c1-2-3-4-5-6-7-10-13-11-8-9-12(13)14;1-2-3-4-8(5,6)7/h2-11H2,1H3;2-4H2,1H3,(H,5,6,7) |
| InChIKey | ZXBXACNCSAUWNU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|