C26H48N2O5S — CID 57135892
2-[octadec-9-enoyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]ethanesulfonic acid (PubChem CID 57135892) has the molecular formula C26H48N2O5S and a molecular weight of 500.75 g/mol. Its IUPAC name is 2-[octadec-9-enoyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]ethanesulfonic acid.
| Compound Name | 2-[octadec-9-enoyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 57135892 |
| Molecular Formula | C26H48N2O5S |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | 2-[octadec-9-enoyl-[2-(2-oxopyrrolidin-1-yl)ethyl]amino]ethanesulfonic acid |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)N(CCN1CCCC1=O)CCS(=O)(=O)O |
| InChI | InChI=1S/C26H48N2O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-25(29)28(23-24-34(31,32)33)22-21-27-20-17-19-26(27)30/h9-10H,2-8,11-24H2,1H3,(H,31,32,33) |
| InChIKey | BGCCRSLJXIJAPW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|