About ethane;1-ethylpyrrolidin-2-one;methanethiol
ethane;1-ethylpyrrolidin-2-one;methanethiol (PubChem CID 91355228) has the molecular formula C9H21NOS
and a molecular weight of 191.34 g/mol. Its IUPAC name is ethane;1-ethylpyrrolidin-2-one;methanethiol.
Molecular Properties
| Compound Name | ethane;1-ethylpyrrolidin-2-one;methanethiol |
| PubChem CID | 91355228 |
| Molecular Formula | C9H21NOS |
| Molecular Weight | 191.34 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | ethane;1-ethylpyrrolidin-2-one;methanethiol |
| SMILES | CC.CCN1CCCC1=O.CS |
| InChI | InChI=1S/C6H11NO.C2H6.CH4S/c1-2-7-5-3-4-6(7)8;2*1-2/h2-5H2,1H3;1-2H3;2H,1H3 |
| InChIKey | WMWYIUWEBMUCMS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethylpyrrolidin-2-one;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethylpyrrolidin-2-one;methanethiol?
The IUPAC name of ethane;1-ethylpyrrolidin-2-one;methanethiol (CID 91355228) is ethane;1-ethylpyrrolidin-2-one;methanethiol.
What is the SMILES notation for ethane;1-ethylpyrrolidin-2-one;methanethiol?
The canonical SMILES for ethane;1-ethylpyrrolidin-2-one;methanethiol is CC.CCN1CCCC1=O.CS.
What is the InChIKey of ethane;1-ethylpyrrolidin-2-one;methanethiol?
The InChIKey is WMWYIUWEBMUCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C2H6.CH4S/c1-2-7-5-3-4-6(7)8;2*1-2/h2-5H2,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;1-ethylpyrrolidin-2-one;methanethiol?
ethane;1-ethylpyrrolidin-2-one;methanethiol has a molecular weight of 191.34 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethylpyrrolidin-2-one;methanethiol is sourced from PubChem (CID 91355228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).