C16H20N2O3 — CID 62017487
1-ethyl-4-(4-oxo-4-phenylbutyl)piperazine-2,3-dione (PubChem CID 62017487) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-ethyl-4-(4-oxo-4-phenylbutyl)piperazine-2,3-dione.
| Compound Name | 1-ethyl-4-(4-oxo-4-phenylbutyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 62017487 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-ethyl-4-(4-oxo-4-phenylbutyl)piperazine-2,3-dione |
| SMILES | CCN1CCN(CCCC(=O)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C16H20N2O3/c1-2-17-11-12-18(16(21)15(17)20)10-6-9-14(19)13-7-4-3-5-8-13/h3-5,7-8H,2,6,9-12H2,1H3 |
| InChIKey | URLZPIATEFHOFN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|