C14H24N4O4 — CID 46492120
N-[2-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]ethyl]-2-methylpropanamide (PubChem CID 46492120) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[2-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 46492120 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[2-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]ethyl]-2-methylpropanamide |
| SMILES | CCN1CCN(CC(=O)NCCNC(=O)C(C)C)C(=O)C1=O |
| InChI | InChI=1S/C14H24N4O4/c1-4-17-7-8-18(14(22)13(17)21)9-11(19)15-5-6-16-12(20)10(2)3/h10H,4-9H2,1-3H3,(H,15,19)(H,16,20) |
| InChIKey | UUMWDXLOUFZROR-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|