C20H28N4O4 — CID 49397345
4-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-3-methyl-N-(2-methylpropyl)benzamide (PubChem CID 49397345) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-3-methyl-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-3-methyl-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 49397345 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 4-[[2-(4-ethyl-2,3-dioxopiperazin-1-yl)acetyl]amino]-3-methyl-N-(2-methylpropyl)benzamide |
| SMILES | CCN1CCN(CC(=O)Nc2ccc(C(=O)NCC(C)C)cc2C)C(=O)C1=O |
| InChI | InChI=1S/C20H28N4O4/c1-5-23-8-9-24(20(28)19(23)27)12-17(25)22-16-7-6-15(10-14(16)4)18(26)21-11-13(2)3/h6-7,10,13H,5,8-9,11-12H2,1-4H3,(H,21,26)(H,22,25) |
| InChIKey | HXSOWGHIOJZPPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|