C21H33N3O4S — CID 56582986
3-methyl-4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]-N-(2-methylpropyl)benzamide (PubChem CID 56582986) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 3-methyl-4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]-N-(2-methylpropyl)benzamide.
| Compound Name | 3-methyl-4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 56582986 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-methyl-4-[[2-[(4-methylcyclohexyl)sulfamoyl]acetyl]amino]-N-(2-methylpropyl)benzamide |
| SMILES | Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)CS(=O)(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C21H33N3O4S/c1-14(2)12-22-21(26)17-7-10-19(16(4)11-17)23-20(25)13-29(27,28)24-18-8-5-15(3)6-9-18/h7,10-11,14-15,18,24H,5-6,8-9,12-13H2,1-4H3,(H,22,26)(H,23,25) |
| InChIKey | NZOVIAHPGHZUQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |