C22H36ClN3O2 — CID 119621174
N-[2-(cycloheptylamino)ethyl]-3-methyl-4-(3-methylbutanoylamino)benzamide;hydrochloride (PubChem CID 119621174) has the molecular formula C22H36ClN3O2 and a molecular weight of 410.00 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-3-methyl-4-(3-methylbutanoylamino)benzamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-3-methyl-4-(3-methylbutanoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119621174 |
| Molecular Formula | C22H36ClN3O2 |
| Molecular Weight | 410.00 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-3-methyl-4-(3-methylbutanoylamino)benzamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NCCNC2CCCCCC2)ccc1NC(=O)CC(C)C.Cl |
| InChI | InChI=1S/C22H35N3O2.ClH/c1-16(2)14-21(26)25-20-11-10-18(15-17(20)3)22(27)24-13-12-23-19-8-6-4-5-7-9-19;/h10-11,15-16,19,23H,4-9,12-14H2,1-3H3,(H,24,27)(H,25,26);1H |
| InChIKey | HUWKFUBFPWFFOR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|