C19H28N2O3 — CID 111471383
N-[(2-hydroxycyclopentyl)methyl]-3-methyl-4-(3-methylbutanoylamino)benzamide (PubChem CID 111471383) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[(2-hydroxycyclopentyl)methyl]-3-methyl-4-(3-methylbutanoylamino)benzamide.
| Compound Name | N-[(2-hydroxycyclopentyl)methyl]-3-methyl-4-(3-methylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 111471383 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(2-hydroxycyclopentyl)methyl]-3-methyl-4-(3-methylbutanoylamino)benzamide |
| SMILES | Cc1cc(C(=O)NCC2CCCC2O)ccc1NC(=O)CC(C)C |
| InChI | InChI=1S/C19H28N2O3/c1-12(2)9-18(23)21-16-8-7-14(10-13(16)3)19(24)20-11-15-5-4-6-17(15)22/h7-8,10,12,15,17,22H,4-6,9,11H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | KCAGEFVKTJICNR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |