C20H25N3O4S — CID 56510951
3-methyl-N-(2-methylpropyl)-4-[[2-(4-sulfamoylphenyl)acetyl]amino]benzamide (PubChem CID 56510951) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpropyl)-4-[[2-(4-sulfamoylphenyl)acetyl]amino]benzamide.
| Compound Name | 3-methyl-N-(2-methylpropyl)-4-[[2-(4-sulfamoylphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 56510951 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 3-methyl-N-(2-methylpropyl)-4-[[2-(4-sulfamoylphenyl)acetyl]amino]benzamide |
| SMILES | Cc1cc(C(=O)NCC(C)C)ccc1NC(=O)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-13(2)12-22-20(25)16-6-9-18(14(3)10-16)23-19(24)11-15-4-7-17(8-5-15)28(21,26)27/h4-10,13H,11-12H2,1-3H3,(H,22,25)(H,23,24)(H2,21,26,27) |
| InChIKey | LTDSNSSQBOVFBS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |