C19H28N4O5S — CID 55791847
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide (PubChem CID 55791847) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55791847 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-N-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]acetamide |
| SMILES | CCN1CCN(CC(=O)NCc2ccc(CS(=O)(=O)NC(C)C)cc2)C(=O)C1=O |
| InChI | InChI=1S/C19H28N4O5S/c1-4-22-9-10-23(19(26)18(22)25)12-17(24)20-11-15-5-7-16(8-6-15)13-29(27,28)21-14(2)3/h5-8,14,21H,4,9-13H2,1-3H3,(H,20,24) |
| InChIKey | IDOWJOJRGILPHA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|