C22H41ClN4O2 — CID 20502285
1-(2-chloroethyl)-3-[2,2-dicyclohexyl-5-(dimethylamino)pentyl]-1-nitrosourea (PubChem CID 20502285) has the molecular formula C22H41ClN4O2 and a molecular weight of 429.05 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[2,2-dicyclohexyl-5-(dimethylamino)pentyl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[2,2-dicyclohexyl-5-(dimethylamino)pentyl]-1-nitrosourea |
|---|---|
| PubChem CID | 20502285 |
| Molecular Formula | C22H41ClN4O2 |
| Molecular Weight | 429.05 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 1-(2-chloroethyl)-3-[2,2-dicyclohexyl-5-(dimethylamino)pentyl]-1-nitrosourea |
| SMILES | CN(C)CCCC(CNC(=O)N(CCCl)N=O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H41ClN4O2/c1-26(2)16-9-14-22(19-10-5-3-6-11-19,20-12-7-4-8-13-20)18-24-21(28)27(25-29)17-15-23/h19-20H,3-18H2,1-2H3,(H,24,28) |
| InChIKey | QSTGTZJLCRBYIQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.05 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|