C9H19ClN4O4 — CID 10401535
1-(2-chloroethyl)-3-[1-(dimethylamino)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-1-nitrosourea (PubChem CID 10401535) has the molecular formula C9H19ClN4O4 and a molecular weight of 282.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[1-(dimethylamino)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-1-nitrosourea.
| Compound Name | 1-(2-chloroethyl)-3-[1-(dimethylamino)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-1-nitrosourea |
|---|---|
| PubChem CID | 10401535 |
| Molecular Formula | C9H19ClN4O4 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 1-(2-chloroethyl)-3-[1-(dimethylamino)-3-hydroxy-2-(hydroxymethyl)propan-2-yl]-1-nitrosourea |
| SMILES | CN(C)CC(CO)(CO)NC(=O)N(CCCl)N=O |
| InChI | InChI=1S/C9H19ClN4O4/c1-13(2)5-9(6-15,7-16)11-8(17)14(12-18)4-3-10/h15-16H,3-7H2,1-2H3,(H,11,17) |
| InChIKey | DXFFUEJOKARSON-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|