C11H20Cl2N4O3 — CID 13361545
N-(2-chloroethyl)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4-methylpentanamide (PubChem CID 13361545) has the molecular formula C11H20Cl2N4O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4-methylpentanamide.
| Compound Name | N-(2-chloroethyl)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 13361545 |
| Molecular Formula | C11H20Cl2N4O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(2-chloroethyl)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)CC(NC(=O)N(CCCl)N=O)C(=O)NCCCl |
| InChI | InChI=1S/C11H20Cl2N4O3/c1-8(2)7-9(10(18)14-5-3-12)15-11(19)17(16-20)6-4-13/h8-9H,3-7H2,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | IIUYTILLVHWNOR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|