C10H20N2O3 — CID 177105985
2-[(2-deuterioacetyl)amino]-N-(2-deuteriooxyethyl)-4-methylpentanamide (PubChem CID 177105985) has the molecular formula C10H20N2O3 and a molecular weight of 218.29 g/mol. Its IUPAC name is 2-[(2-deuterioacetyl)amino]-N-(2-deuteriooxyethyl)-4-methylpentanamide.
| Compound Name | 2-[(2-deuterioacetyl)amino]-N-(2-deuteriooxyethyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 177105985 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-[(2-deuterioacetyl)amino]-N-(2-deuteriooxyethyl)-4-methylpentanamide |
| SMILES | [2H]CC(=O)NC(CC(C)C)C(=O)NCCO[2H] |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)6-9(12-8(3)14)10(15)11-4-5-13/h7,9,13H,4-6H2,1-3H3,(H,11,15)(H,12,14)/i3D,13D |
| InChIKey | SFODDAZVJUPTIV-CCIBYJQVSA-N |
| XLogP | -0.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|