C15H30BN3O5 — CID 142234996
[1-[[2-[(2-acetamido-4-methylpentanoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 142234996) has the molecular formula C15H30BN3O5 and a molecular weight of 343.23 g/mol. Its IUPAC name is [1-[[2-[(2-acetamido-4-methylpentanoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[2-[(2-acetamido-4-methylpentanoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 142234996 |
| Molecular Formula | C15H30BN3O5 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | [1-[[2-[(2-acetamido-4-methylpentanoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC(C)C)B(O)O |
| InChI | InChI=1S/C15H30BN3O5/c1-9(2)6-12(18-11(5)20)15(22)17-8-14(21)19-13(16(23)24)7-10(3)4/h9-10,12-13,23-24H,6-8H2,1-5H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | ZRTUSKFNJROFEN-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|