C15H23BCl2N2O4 — CID 174152111
[(1R)-1-[[2-[[(2Z,4Z)-3,6-dichloro-2-methylhepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 174152111) has the molecular formula C15H23BCl2N2O4 and a molecular weight of 377.08 g/mol. Its IUPAC name is [(1R)-1-[[2-[[(2Z,4Z)-3,6-dichloro-2-methylhepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[[(2Z,4Z)-3,6-dichloro-2-methylhepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 174152111 |
| Molecular Formula | C15H23BCl2N2O4 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | [(1R)-1-[[2-[[(2Z,4Z)-3,6-dichloro-2-methylhepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | C=C(Cl)/C=C\C(Cl)=C(/C)C(=O)NCC(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C15H23BCl2N2O4/c1-9(2)7-13(16(23)24)20-14(21)8-19-15(22)11(4)12(18)6-5-10(3)17/h5-6,9,13,23-24H,3,7-8H2,1-2,4H3,(H,19,22)(H,20,21)/b6-5-,12-11-/t13-/m0/s1 |
| InChIKey | LDKOKOUJMWXGHC-BIMQGXNQSA-N |
| XLogP | 1.47 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|