C14H21BBrClN2O4 — CID 163427321
[(1R)-1-[[2-[[(2Z,4Z)-6-bromo-3-chlorohepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163427321) has the molecular formula C14H21BBrClN2O4 and a molecular weight of 407.50 g/mol. Its IUPAC name is [(1R)-1-[[2-[[(2Z,4Z)-6-bromo-3-chlorohepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[[(2Z,4Z)-6-bromo-3-chlorohepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163427321 |
| Molecular Formula | C14H21BBrClN2O4 |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [(1R)-1-[[2-[[(2Z,4Z)-6-bromo-3-chlorohepta-2,4,6-trienoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | C=C(Br)/C=C\C(Cl)=C\C(=O)NCC(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C14H21BBrClN2O4/c1-9(2)6-12(15(22)23)19-14(21)8-18-13(20)7-11(17)5-4-10(3)16/h4-5,7,9,12,22-23H,3,6,8H2,1-2H3,(H,18,20)(H,19,21)/b5-4-,11-7-/t12-/m0/s1 |
| InChIKey | ANQJZPWDORXXQN-KSNNPXCSSA-N |
| XLogP | 1.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|