C15H18BBr2F3N2O4 — CID 145402830
[(1R)-1-[[2-[[2,5-dibromo-3-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid (PubChem CID 145402830) has the molecular formula C15H18BBr2F3N2O4 and a molecular weight of 517.93 g/mol. Its IUPAC name is [(1R)-1-[[2-[[2,5-dibromo-3-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[2-[[2,5-dibromo-3-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 145402830 |
| Molecular Formula | C15H18BBr2F3N2O4 |
| Molecular Weight | 517.93 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | [(1R)-1-[[2-[[2,5-dibromo-3-(trifluoromethyl)benzoyl]amino]acetyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CNC(=O)c1cc(Br)cc(C(F)(F)F)c1Br)B(O)O |
| InChI | InChI=1S/C15H18BBr2F3N2O4/c1-7(2)3-11(16(26)27)23-12(24)6-22-14(25)9-4-8(17)5-10(13(9)18)15(19,20)21/h4-5,7,11,26-27H,3,6H2,1-2H3,(H,22,25)(H,23,24)/t11-/m0/s1 |
| InChIKey | UBHAGJUYXAUCSX-NSHDSACASA-N |
| XLogP | 2.50 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.93 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|